About 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid
4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid (PubChem CID 11947956) has the molecular formula C20H19NO5S
and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid.
Molecular Properties
| Compound Name | 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid |
| PubChem CID | 11947956 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(CCCC(=O)O)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NO5S/c1-27(24,25)16-12-10-14(11-13-16)19-20(15-6-3-2-4-7-15)26-17(21-19)8-5-9-18(22)23/h2-4,6-7,10-13H,5,8-9H2,1H3,(H,22,23) |
| InChIKey | UFPHEVPZBIPWAN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid?
The IUPAC name of 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid (CID 11947956) is 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid.
What is the SMILES notation for 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid?
The canonical SMILES for 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid is CS(=O)(=O)c1ccc(-c2nc(CCCC(=O)O)oc2-c2ccccc2)cc1.
What is the InChIKey of 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid?
The InChIKey is UFPHEVPZBIPWAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO5S/c1-27(24,25)16-12-10-14(11-13-16)19-20(15-6-3-2-4-7-15)26-17(21-19)8-5-9-18(22)23/h2-4,6-7,10-13H,5,8-9H2,1H3,(H,22,23).
What are the key properties of 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid?
4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid has a molecular weight of 385.44 g/mol, XLogP of 3.82, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-methylsulfonylphenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid is sourced from PubChem (CID 11947956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).