C17H12F2N2O5S — CID 11947996
2-[5-(3,4-difluorophenyl)-4-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetic acid (PubChem CID 11947996) has the molecular formula C17H12F2N2O5S and a molecular weight of 394.36 g/mol. Its IUPAC name is 2-[5-(3,4-difluorophenyl)-4-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetic acid.
| Compound Name | 2-[5-(3,4-difluorophenyl)-4-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 11947996 |
| Molecular Formula | C17H12F2N2O5S |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[5-(3,4-difluorophenyl)-4-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2nc(CC(=O)O)oc2-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H12F2N2O5S/c18-12-6-3-10(7-13(12)19)17-16(21-14(26-17)8-15(22)23)9-1-4-11(5-2-9)27(20,24)25/h1-7H,8H2,(H,22,23)(H2,20,24,25) |
| InChIKey | AJFPXSPVTUPFFX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |