About 2-benzylnaphthalene
2-benzylnaphthalene (PubChem CID 11948) has the molecular formula C17H14
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-benzylnaphthalene.
Molecular Properties
| Compound Name | 2-benzylnaphthalene |
| PubChem CID | 11948 |
| Molecular Formula | C17H14 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-benzylnaphthalene |
| SMILES | c1ccc(Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C17H14/c1-2-6-14(7-3-1)12-15-10-11-16-8-4-5-9-17(16)13-15/h1-11,13H,12H2 |
| InChIKey | JASHTKAXQWIZGF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-benzylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylnaphthalene?
The IUPAC name of 2-benzylnaphthalene (CID 11948) is 2-benzylnaphthalene.
What is the SMILES notation for 2-benzylnaphthalene?
The canonical SMILES for 2-benzylnaphthalene is c1ccc(Cc2ccc3ccccc3c2)cc1.
What is the InChIKey of 2-benzylnaphthalene?
The InChIKey is JASHTKAXQWIZGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14/c1-2-6-14(7-3-1)12-15-10-11-16-8-4-5-9-17(16)13-15/h1-11,13H,12H2.
What are the key properties of 2-benzylnaphthalene?
2-benzylnaphthalene has a molecular weight of 218.30 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylnaphthalene is sourced from PubChem (CID 11948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).