C18H24BrN3O2 — CID 119481407
N-(2-aminoethyl)-1-[1-(4-bromophenyl)cyclopropanecarbonyl]piperidine-3-carboxamide (PubChem CID 119481407) has the molecular formula C18H24BrN3O2 and a molecular weight of 394.31 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[1-(4-bromophenyl)cyclopropanecarbonyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[1-(4-bromophenyl)cyclopropanecarbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119481407 |
| Molecular Formula | C18H24BrN3O2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(2-aminoethyl)-1-[1-(4-bromophenyl)cyclopropanecarbonyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)C2(c3ccc(Br)cc3)CC2)C1 |
| InChI | InChI=1S/C18H24BrN3O2/c19-15-5-3-14(4-6-15)18(7-8-18)17(24)22-11-1-2-13(12-22)16(23)21-10-9-20/h3-6,13H,1-2,7-12,20H2,(H,21,23) |
| InChIKey | YAZWVTZSECVNRQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |