About methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate
methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 11948196) has the molecular formula C19H18N2O5S
and a molecular weight of 386.43 g/mol. Its IUPAC name is methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate |
| PubChem CID | 11948196 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | COC(=O)CCc1nc(-c2ccccc2)c(-c2ccc(S(N)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C19H18N2O5S/c1-25-17(22)12-11-16-21-18(13-5-3-2-4-6-13)19(26-16)14-7-9-15(10-8-14)27(20,23)24/h2-10H,11-12H2,1H3,(H2,20,23,24) |
| InChIKey | OVCISYVCYMHBKX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate?
The IUPAC name of methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate (CID 11948196) is methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate.
What is the SMILES notation for methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate?
The canonical SMILES for methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate is COC(=O)CCc1nc(-c2ccccc2)c(-c2ccc(S(N)(=O)=O)cc2)o1.
What is the InChIKey of methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate?
The InChIKey is OVCISYVCYMHBKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5S/c1-25-17(22)12-11-16-21-18(13-5-3-2-4-6-13)19(26-16)14-7-9-15(10-8-14)27(20,23)24/h2-10H,11-12H2,1H3,(H2,20,23,24).
What are the key properties of methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate?
methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate has a molecular weight of 386.43 g/mol, XLogP of 2.76, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]propanoate is sourced from PubChem (CID 11948196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).