C25H26N6OS — CID 11948377
N-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine (PubChem CID 11948377) has the molecular formula C25H26N6OS and a molecular weight of 458.59 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine.
| Compound Name | N-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine |
|---|---|
| PubChem CID | 11948377 |
| Molecular Formula | C25H26N6OS |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine |
| SMILES | COc1ccc2nccc(-n3cc4c(n3)CCC(NCc3ccc5c(c3)NCCS5)C4)c2n1 |
| InChI | InChI=1S/C25H26N6OS/c1-32-24-7-5-20-25(29-24)22(8-9-26-20)31-15-17-13-18(3-4-19(17)30-31)28-14-16-2-6-23-21(12-16)27-10-11-33-23/h2,5-9,12,15,18,27-28H,3-4,10-11,13-14H2,1H3 |
| InChIKey | WFOYAANQGHZATP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |