C26H26N4O3 — CID 11948421
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(6-methoxyquinolin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine (PubChem CID 11948421) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(6-methoxyquinolin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(6-methoxyquinolin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine |
|---|---|
| PubChem CID | 11948421 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(6-methoxyquinolin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine |
| SMILES | COc1ccc2nccc(-n3cc4c(n3)CCC(NCc3ccc5c(c3)OCCO5)C4)c2c1 |
| InChI | InChI=1S/C26H26N4O3/c1-31-20-4-6-23-21(14-20)24(8-9-27-23)30-16-18-13-19(3-5-22(18)29-30)28-15-17-2-7-25-26(12-17)33-11-10-32-25/h2,4,6-9,12,14,16,19,28H,3,5,10-11,13,15H2,1H3 |
| InChIKey | FGNGPJZCJPWKPC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |