About 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile
5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile (PubChem CID 11948509) has the molecular formula C8ClF3N2
and a molecular weight of 216.55 g/mol. Its IUPAC name is 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile |
| PubChem CID | 11948509 |
| Molecular Formula | C8ClF3N2 |
| Molecular Weight | 216.55 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(Cl)c(F)c(C#N)c1F |
| InChI | InChI=1S/C8ClF3N2/c9-5-7(11)3(1-13)6(10)4(2-14)8(5)12 |
| InChIKey | GBKXRWNDORMHSG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile?
The IUPAC name of 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile (CID 11948509) is 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile.
What is the SMILES notation for 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile?
The canonical SMILES for 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile is N#Cc1c(F)c(Cl)c(F)c(C#N)c1F.
What is the InChIKey of 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile?
The InChIKey is GBKXRWNDORMHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8ClF3N2/c9-5-7(11)3(1-13)6(10)4(2-14)8(5)12.
What are the key properties of 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile?
5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile has a molecular weight of 216.55 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4,6-trifluorobenzene-1,3-dicarbonitrile is sourced from PubChem (CID 11948509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).