C25H22ClN5O2 — CID 11948541
(E)-3-(4-chlorophenyl)-N-[2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-yl]prop-2-enamide (PubChem CID 11948541) has the molecular formula C25H22ClN5O2 and a molecular weight of 459.94 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11948541 |
| Molecular Formula | C25H22ClN5O2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-yl]prop-2-enamide |
| SMILES | COc1ccc2nccc(-n3cc4c(n3)CCC(NC(=O)/C=C/c3ccc(Cl)cc3)C4)c2n1 |
| InChI | InChI=1S/C25H22ClN5O2/c1-33-24-11-9-21-25(29-24)22(12-13-27-21)31-15-17-14-19(7-8-20(17)30-31)28-23(32)10-4-16-2-5-18(26)6-3-16/h2-6,9-13,15,19H,7-8,14H2,1H3,(H,28,32)/b10-4+ |
| InChIKey | MAIDQBRXYHWGMP-ONNFQVAWSA-N |
| XLogP | 4.16 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|