About Dosamix
Dosamix (PubChem CID 119486) has the molecular formula C17H25Cl2N7O2
and a molecular weight of 430.30 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | Dosamix |
| PubChem CID | 119486 |
| Molecular Formula | C17H25Cl2N7O2 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
| SMILES | CCNC1=NC(=NC(=N1)Cl)NCC.CN(C)C(=O)NC1=CC(=C(C=C1)OC)Cl |
| InChI | InChI=1S/C10H13ClN2O2.C7H12ClN5/c1-13(2)10(14)12-7-4-5-9(15-3)8(11)6-7;1-3-9-6-11-5(8)12-7(13-6)10-4-2/h4-6H,1-3H3,(H,12,14);3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChIKey | VSQAWKVYUGTCFE-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 104.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | 354 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Dosamix with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dosamix?
The IUPAC name of Dosamix (CID 119486) is 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine;3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea.
What is the SMILES notation for Dosamix?
The canonical SMILES for Dosamix is CCNC1=NC(=NC(=N1)Cl)NCC.CN(C)C(=O)NC1=CC(=C(C=C1)OC)Cl.
What is the InChIKey of Dosamix?
The InChIKey is VSQAWKVYUGTCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2.C7H12ClN5/c1-13(2)10(14)12-7-4-5-9(15-3)8(11)6-7;1-3-9-6-11-5(8)12-7(13-6)10-4-2/h4-6H,1-3H3,(H,12,14);3-4H2,1-2H3,(H2,9,10,11,12,13).
What are the key properties of Dosamix?
Dosamix has a molecular weight of 430.30 g/mol, XLogP of not available, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Dosamix is sourced from PubChem (CID 119486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).