About (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one
(4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11948706) has the molecular formula C11H12N4O2S
and a molecular weight of 264.31 g/mol. Its IUPAC name is (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 11948706 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CSN1C(=O)O[C@@H](CN=[N+]=[N-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H12N4O2S/c1-18-15-10(8-5-3-2-4-6-8)9(7-13-14-12)17-11(15)16/h2-6,9-10H,7H2,1H3/t9-,10-/m0/s1 |
| InChIKey | CVLSMPRYYWMNIF-UWVGGRQHSA-N |
| XLogP | 3.14 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one (CID 11948706) is (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one is CSN1C(=O)O[C@@H](CN=[N+]=[N-])[C@@H]1c1ccccc1.
What is the InChIKey of (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one?
The InChIKey is CVLSMPRYYWMNIF-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H12N4O2S/c1-18-15-10(8-5-3-2-4-6-8)9(7-13-14-12)17-11(15)16/h2-6,9-10H,7H2,1H3/t9-,10-/m0/s1.
What are the key properties of (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one?
(4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one has a molecular weight of 264.31 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-5-(azidomethyl)-3-methylsulfanyl-4-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 11948706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).