C15H19ClN6O3 — CID 119487632
[3-(methylamino)piperidin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone;hydrochloride (PubChem CID 119487632) has the molecular formula C15H19ClN6O3 and a molecular weight of 366.81 g/mol. Its IUPAC name is [3-(methylamino)piperidin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone;hydrochloride.
| Compound Name | [3-(methylamino)piperidin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119487632 |
| Molecular Formula | C15H19ClN6O3 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [3-(methylamino)piperidin-1-yl]-[3-nitro-4-(1,2,4-triazol-1-yl)phenyl]methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2ccc(-n3cncn3)c([N+](=O)[O-])c2)C1.Cl |
| InChI | InChI=1S/C15H18N6O3.ClH/c1-16-12-3-2-6-19(8-12)15(22)11-4-5-13(14(7-11)21(23)24)20-10-17-9-18-20;/h4-5,7,9-10,12,16H,2-3,6,8H2,1H3;1H |
| InChIKey | HVIDCJFCBYABAU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|