C22H34ClN9O2 — CID 11948770
3-N-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 11948770) has the molecular formula C22H34ClN9O2 and a molecular weight of 492.03 g/mol. Its IUPAC name is 3-N-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 11948770 |
| Molecular Formula | C22H34ClN9O2 |
| Molecular Weight | 492.03 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 3-N-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | Cc1nnc(NN=Cc2cc([N+](=O)[O-])c(N3CCC(C)CC3)cc2N2CCC(C)CC2)n1N.Cl |
| InChI | InChI=1S/C22H33N9O2.ClH/c1-15-4-8-28(9-5-15)19-13-20(29-10-6-16(2)7-11-29)21(31(32)33)12-18(19)14-24-26-22-27-25-17(3)30(22)23;/h12-16H,4-11,23H2,1-3H3,(H,26,27);1H |
| InChIKey | GVQCQRDATWJHAO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.03 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|