C15H20N2O7 — CID 11948773
N-(4-methoxyphenyl)-2-morpholin-4-ylacetamide;oxalic acid (PubChem CID 11948773) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-morpholin-4-ylacetamide;oxalic acid.
| Compound Name | N-(4-methoxyphenyl)-2-morpholin-4-ylacetamide;oxalic acid |
|---|---|
| PubChem CID | 11948773 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-(4-methoxyphenyl)-2-morpholin-4-ylacetamide;oxalic acid |
| SMILES | COc1ccc(NC(=O)CN2CCOCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H18N2O3.C2H2O4/c1-17-12-4-2-11(3-5-12)14-13(16)10-15-6-8-18-9-7-15;3-1(4)2(5)6/h2-5H,6-10H2,1H3,(H,14,16);(H,3,4)(H,5,6) |
| InChIKey | WGOJTMDNXYAFOP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|