About 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride
2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride (PubChem CID 11948814) has the molecular formula C16H18Cl3NO
and a molecular weight of 346.69 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride |
| PubChem CID | 11948814 |
| Molecular Formula | C16H18Cl3NO |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride |
| SMILES | CC(NCc1ccc(Cl)c(Cl)c1)C(O)c1ccccc1.Cl |
| InChI | InChI=1S/C16H17Cl2NO.ClH/c1-11(16(20)13-5-3-2-4-6-13)19-10-12-7-8-14(17)15(18)9-12;/h2-9,11,16,19-20H,10H2,1H3;1H |
| InChIKey | JATAYCHUHBDSAZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride?
The IUPAC name of 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride (CID 11948814) is 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride.
What is the SMILES notation for 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride?
The canonical SMILES for 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride is CC(NCc1ccc(Cl)c(Cl)c1)C(O)c1ccccc1.Cl.
What is the InChIKey of 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride?
The InChIKey is JATAYCHUHBDSAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2NO.ClH/c1-11(16(20)13-5-3-2-4-6-13)19-10-12-7-8-14(17)15(18)9-12;/h2-9,11,16,19-20H,10H2,1H3;1H.
What are the key properties of 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride?
2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride has a molecular weight of 346.69 g/mol, XLogP of 4.63, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichlorophenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride is sourced from PubChem (CID 11948814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).