About N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride
N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride (PubChem CID 11948819) has the molecular formula C20H18Cl2FN
and a molecular weight of 362.28 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride |
| PubChem CID | 11948819 |
| Molecular Formula | C20H18Cl2FN |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride |
| SMILES | Cl.Fc1cccc(Cl)c1CNC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17ClFN.ClH/c21-18-12-7-13-19(22)17(18)14-23-20(15-8-3-1-4-9-15)16-10-5-2-6-11-16;/h1-13,20,23H,14H2;1H |
| InChIKey | GDDXOVDCNNYUFG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride?
The IUPAC name of N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride (CID 11948819) is N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride.
What is the SMILES notation for N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride?
The canonical SMILES for N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride is Cl.Fc1cccc(Cl)c1CNC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride?
The InChIKey is GDDXOVDCNNYUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClFN.ClH/c21-18-12-7-13-19(22)17(18)14-23-20(15-8-3-1-4-9-15)16-10-5-2-6-11-16;/h1-13,20,23H,14H2;1H.
What are the key properties of N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride?
N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride has a molecular weight of 362.28 g/mol, XLogP of 5.78, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-6-fluorophenyl)methyl]-1,1-diphenylmethanamine;hydrochloride is sourced from PubChem (CID 11948819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).