About 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride
4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 11948922) has the molecular formula C15H14Cl3NO2
and a molecular weight of 346.64 g/mol. Its IUPAC name is 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride |
| PubChem CID | 11948922 |
| Molecular Formula | C15H14Cl3NO2 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CNCc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2NO2.ClH/c16-13-3-1-2-12(14(13)17)9-18-8-10-4-6-11(7-5-10)15(19)20;/h1-7,18H,8-9H2,(H,19,20);1H |
| InChIKey | VZGWILRUYWHWNN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride?
The IUPAC name of 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride (CID 11948922) is 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride.
What is the SMILES notation for 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride?
The canonical SMILES for 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride is Cl.O=C(O)c1ccc(CNCc2cccc(Cl)c2Cl)cc1.
What is the InChIKey of 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride?
The InChIKey is VZGWILRUYWHWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO2.ClH/c16-13-3-1-2-12(14(13)17)9-18-8-10-4-6-11(7-5-10)15(19)20;/h1-7,18H,8-9H2,(H,19,20);1H.
What are the key properties of 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride?
4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride has a molecular weight of 346.64 g/mol, XLogP of 4.40, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2,3-dichlorophenyl)methylamino]methyl]benzoic acid;hydrochloride is sourced from PubChem (CID 11948922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).