C14H28ClN3O3S — CID 119490378
(1-ethylsulfonylpiperidin-3-yl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119490378) has the molecular formula C14H28ClN3O3S and a molecular weight of 353.92 g/mol. Its IUPAC name is (1-ethylsulfonylpiperidin-3-yl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (1-ethylsulfonylpiperidin-3-yl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119490378 |
| Molecular Formula | C14H28ClN3O3S |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (1-ethylsulfonylpiperidin-3-yl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CCS(=O)(=O)N1CCCC(C(=O)N2CCCC(NC)C2)C1.Cl |
| InChI | InChI=1S/C14H27N3O3S.ClH/c1-3-21(19,20)17-9-4-6-12(10-17)14(18)16-8-5-7-13(11-16)15-2;/h12-13,15H,3-11H2,1-2H3;1H |
| InChIKey | GFOIFESMZUAWNH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |