C17H27ClN2OS — CID 119490553
3-methyl-1-[3-(methylamino)piperidin-1-yl]-2-phenylsulfanylbutan-1-one;hydrochloride (PubChem CID 119490553) has the molecular formula C17H27ClN2OS and a molecular weight of 342.94 g/mol. Its IUPAC name is 3-methyl-1-[3-(methylamino)piperidin-1-yl]-2-phenylsulfanylbutan-1-one;hydrochloride.
| Compound Name | 3-methyl-1-[3-(methylamino)piperidin-1-yl]-2-phenylsulfanylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119490553 |
| Molecular Formula | C17H27ClN2OS |
| Molecular Weight | 342.94 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-methyl-1-[3-(methylamino)piperidin-1-yl]-2-phenylsulfanylbutan-1-one;hydrochloride |
| SMILES | CNC1CCCN(C(=O)C(Sc2ccccc2)C(C)C)C1.Cl |
| InChI | InChI=1S/C17H26N2OS.ClH/c1-13(2)16(21-15-9-5-4-6-10-15)17(20)19-11-7-8-14(12-19)18-3;/h4-6,9-10,13-14,16,18H,7-8,11-12H2,1-3H3;1H |
| InChIKey | XFLCCUSLYJKVIW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.94 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |