C19H25NO5 — CID 11949101
methyl (2S,3aR,6S,7aR)-6-hydroxy-1-[(4-methoxycarbonylphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 11949101) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl (2S,3aR,6S,7aR)-6-hydroxy-1-[(4-methoxycarbonylphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,6S,7aR)-6-hydroxy-1-[(4-methoxycarbonylphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 11949101 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | methyl (2S,3aR,6S,7aR)-6-hydroxy-1-[(4-methoxycarbonylphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2[C@@H]3C[C@@H](O)CC[C@@H]3C[C@H]2C(=O)OC)cc1 |
| InChI | InChI=1S/C19H25NO5/c1-24-18(22)13-5-3-12(4-6-13)11-20-16-10-15(21)8-7-14(16)9-17(20)19(23)25-2/h3-6,14-17,21H,7-11H2,1-2H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | DVWPAZRSQCPMKZ-TWMKSMIVSA-N |
| XLogP | 1.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |