C18H25NO4 — CID 11949114
methyl (2S,3aS,6R,7aS)-6-hydroxy-1-[(4-methoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 11949114) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl (2S,3aS,6R,7aS)-6-hydroxy-1-[(4-methoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aS,6R,7aS)-6-hydroxy-1-[(4-methoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 11949114 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | methyl (2S,3aS,6R,7aS)-6-hydroxy-1-[(4-methoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CC[C@@H](O)C[C@@H]2N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-22-15-7-3-12(4-8-15)11-19-16-10-14(20)6-5-13(16)9-17(19)18(21)23-2/h3-4,7-8,13-14,16-17,20H,5-6,9-11H2,1-2H3/t13-,14+,16-,17-/m0/s1 |
| InChIKey | BNLMZNHYUQVKBY-FSDCSDTHSA-N |
| XLogP | 1.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |