C24H29NO6 — CID 11949137
methyl (2S,3aS,4S,5S,6S,7aR)-1-(2,2-diphenylethyl)-3a,4,5,6-tetrahydroxy-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylate (PubChem CID 11949137) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl (2S,3aS,4S,5S,6S,7aR)-1-(2,2-diphenylethyl)-3a,4,5,6-tetrahydroxy-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylate.
| Compound Name | methyl (2S,3aS,4S,5S,6S,7aR)-1-(2,2-diphenylethyl)-3a,4,5,6-tetrahydroxy-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylate |
|---|---|
| PubChem CID | 11949137 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | methyl (2S,3aS,4S,5S,6S,7aR)-1-(2,2-diphenylethyl)-3a,4,5,6-tetrahydroxy-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(O)[C@@H](O)[C@@H](O)[C@@H](O)C[C@H]2N1CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29NO6/c1-31-23(29)18-13-24(30)20(12-19(26)21(27)22(24)28)25(18)14-17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17-22,26-28,30H,12-14H2,1H3/t18-,19-,20+,21-,22-,24-/m0/s1 |
| InChIKey | OJCNLBWMVLAYRR-HAGWKEGXSA-N |
| XLogP | 0.65 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |