C12H24Cl2N2O — CID 119493166
1-[3-(methylamino)piperidin-1-yl]hex-5-en-1-one;dihydrochloride (PubChem CID 119493166) has the molecular formula C12H24Cl2N2O and a molecular weight of 283.24 g/mol. Its IUPAC name is 1-[3-(methylamino)piperidin-1-yl]hex-5-en-1-one;dihydrochloride.
| Compound Name | 1-[3-(methylamino)piperidin-1-yl]hex-5-en-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119493166 |
| Molecular Formula | C12H24Cl2N2O |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-[3-(methylamino)piperidin-1-yl]hex-5-en-1-one;dihydrochloride |
| SMILES | C=CCCCC(=O)N1CCCC(NC)C1.Cl.Cl |
| InChI | InChI=1S/C12H22N2O.2ClH/c1-3-4-5-8-12(15)14-9-6-7-11(10-14)13-2;;/h3,11,13H,1,4-10H2,2H3;2*1H |
| InChIKey | RERIHPDXYGNBHI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|