C14H20Cl2N2O2 — CID 119493215
(4-chloro-2-methoxyphenyl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119493215) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is (4-chloro-2-methoxyphenyl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (4-chloro-2-methoxyphenyl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119493215 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (4-chloro-2-methoxyphenyl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2ccc(Cl)cc2OC)C1.Cl |
| InChI | InChI=1S/C14H19ClN2O2.ClH/c1-16-11-4-3-7-17(9-11)14(18)12-6-5-10(15)8-13(12)19-2;/h5-6,8,11,16H,3-4,7,9H2,1-2H3;1H |
| InChIKey | ZTCGHHUQUWMUHF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |