C8H17N3O3 — CID 11949372
(2S)-2-[[(2S)-2,3-diaminopropanoyl]amino]-3-methylbutanoic acid (PubChem CID 11949372) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2,3-diaminopropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2,3-diaminopropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 11949372 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (2S)-2-[[(2S)-2,3-diaminopropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CN)C(=O)O |
| InChI | InChI=1S/C8H17N3O3/c1-4(2)6(8(13)14)11-7(12)5(10)3-9/h4-6H,3,9-10H2,1-2H3,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | ZMGCQSZHFWURHI-WDSKDSINSA-N |
| XLogP | -1.50 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |