C16H21Cl2N5O — CID 119494408
6-methyl-N-(5-piperazin-1-yl-2-pyridinyl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 119494408) has the molecular formula C16H21Cl2N5O and a molecular weight of 370.28 g/mol. Its IUPAC name is 6-methyl-N-(5-piperazin-1-yl-2-pyridinyl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | 6-methyl-N-(5-piperazin-1-yl-2-pyridinyl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119494408 |
| Molecular Formula | C16H21Cl2N5O |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 6-methyl-N-(5-piperazin-1-yl-2-pyridinyl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCNCC3)cn2)cn1.Cl.Cl |
| InChI | InChI=1S/C16H19N5O.2ClH/c1-12-2-3-13(10-18-12)16(22)20-15-5-4-14(11-19-15)21-8-6-17-7-9-21;;/h2-5,10-11,17H,6-9H2,1H3,(H,19,20,22);2*1H |
| InChIKey | KGFWHHZWVKOMEB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |