C36H35F3N6O2 — CID 11949536
3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-N-(4-fluorophenyl)-4-methylbenzamide (PubChem CID 11949536) has the molecular formula C36H35F3N6O2 and a molecular weight of 640.71 g/mol. Its IUPAC name is 3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-N-(4-fluorophenyl)-4-methylbenzamide.
| Compound Name | 3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-N-(4-fluorophenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 11949536 |
| Molecular Formula | C36H35F3N6O2 |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | 3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-N-(4-fluorophenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(F)cc2)cc1-c1nc(NC2CC(C)(C)NC(C)(C)C2)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C36H35F3N6O2/c1-20-9-10-21(33(47)40-23-13-11-22(37)12-14-23)17-26(20)30-25-15-16-29(46)45(31-27(38)7-6-8-28(31)39)32(25)43-34(42-30)41-24-18-35(2,3)44-36(4,5)19-24/h6-17,24,44H,18-19H2,1-5H3,(H,40,47)(H,41,42,43) |
| InChIKey | FWIMJSZEAQGRRA-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |