About 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole
1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole (PubChem CID 11949839) has the molecular formula C17H13Cl2FN2S
and a molecular weight of 367.28 g/mol. Its IUPAC name is 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole.
Molecular Properties
| Compound Name | 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole |
| PubChem CID | 11949839 |
| Molecular Formula | C17H13Cl2FN2S |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole |
| SMILES | Fc1cccc(SCc2nccn2Cc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C17H13Cl2FN2S/c18-13-6-12(7-14(19)8-13)10-22-5-4-21-17(22)11-23-16-3-1-2-15(20)9-16/h1-9H,10-11H2 |
| InChIKey | WEFHXCHGFNJDNZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole?
The IUPAC name of 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole (CID 11949839) is 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole.
What is the SMILES notation for 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole?
The canonical SMILES for 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole is Fc1cccc(SCc2nccn2Cc2cc(Cl)cc(Cl)c2)c1.
What is the InChIKey of 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole?
The InChIKey is WEFHXCHGFNJDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2FN2S/c18-13-6-12(7-14(19)8-13)10-22-5-4-21-17(22)11-23-16-3-1-2-15(20)9-16/h1-9H,10-11H2.
What are the key properties of 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole?
1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole has a molecular weight of 367.28 g/mol, XLogP of 5.67, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichlorophenyl)methyl]-2-[(3-fluorophenyl)sulfanylmethyl]imidazole is sourced from PubChem (CID 11949839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).