C15H18ClN3O2 — CID 119499058
N-(3-aminobutyl)-2-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]acetamide (PubChem CID 119499058) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]acetamide.
| Compound Name | N-(3-aminobutyl)-2-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]acetamide |
|---|---|
| PubChem CID | 119499058 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(3-aminobutyl)-2-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]acetamide |
| SMILES | CC(N)CCNC(=O)Cc1coc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-10(17)6-7-18-14(20)8-13-9-21-15(19-13)11-2-4-12(16)5-3-11/h2-5,9-10H,6-8,17H2,1H3,(H,18,20) |
| InChIKey | OWXXBOWEWLLRTR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |