C16H21FN4O — CID 119499692
N-(3-aminobutyl)-4-(3,5-dimethylpyrazol-1-yl)-3-fluorobenzamide (PubChem CID 119499692) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(3-aminobutyl)-4-(3,5-dimethylpyrazol-1-yl)-3-fluorobenzamide.
| Compound Name | N-(3-aminobutyl)-4-(3,5-dimethylpyrazol-1-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 119499692 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N-(3-aminobutyl)-4-(3,5-dimethylpyrazol-1-yl)-3-fluorobenzamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)NCCC(C)N)cc2F)n1 |
| InChI | InChI=1S/C16H21FN4O/c1-10(18)6-7-19-16(22)13-4-5-15(14(17)9-13)21-12(3)8-11(2)20-21/h4-5,8-10H,6-7,18H2,1-3H3,(H,19,22) |
| InChIKey | LCSHESHWZZZFMX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |