C13H22ClN3O3S — CID 119500419
5-(ethylsulfamoyl)-2-methyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride (PubChem CID 119500419) has the molecular formula C13H22ClN3O3S and a molecular weight of 335.86 g/mol. Its IUPAC name is 5-(ethylsulfamoyl)-2-methyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 5-(ethylsulfamoyl)-2-methyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119500419 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-(ethylsulfamoyl)-2-methyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
| SMILES | CCNS(=O)(=O)c1ccc(C)c(C(=O)NCCNC)c1.Cl |
| InChI | InChI=1S/C13H21N3O3S.ClH/c1-4-16-20(18,19)11-6-5-10(2)12(9-11)13(17)15-8-7-14-3;/h5-6,9,14,16H,4,7-8H2,1-3H3,(H,15,17);1H |
| InChIKey | LAMAVSLWQLYYJO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|