C11H17ClN4O3S — CID 119500598
N-[2-(methylamino)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride (PubChem CID 119500598) has the molecular formula C11H17ClN4O3S and a molecular weight of 320.80 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119500598 |
| Molecular Formula | C11H17ClN4O3S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)C1=CC=CN2CCS(=O)(=O)N=C12.Cl |
| InChI | InChI=1S/C11H16N4O3S.ClH/c1-12-4-5-13-11(16)9-3-2-6-15-7-8-19(17,18)14-10(9)15;/h2-3,6,12H,4-5,7-8H2,1H3,(H,13,16);1H |
| InChIKey | DENZLKXQIMFMTK-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|