C15H19Cl2N3O3S — CID 119501589
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(methylamino)ethyl]-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119501589) has the molecular formula C15H19Cl2N3O3S and a molecular weight of 392.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(methylamino)ethyl]-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(methylamino)ethyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119501589 |
| Molecular Formula | C15H19Cl2N3O3S |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(methylamino)ethyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | CNCCNC(=O)c1csc(-c2ccc3c(c2)OCCO3)n1.Cl.Cl |
| InChI | InChI=1S/C15H17N3O3S.2ClH/c1-16-4-5-17-14(19)11-9-22-15(18-11)10-2-3-12-13(8-10)21-7-6-20-12;;/h2-3,8-9,16H,4-7H2,1H3,(H,17,19);2*1H |
| InChIKey | KADAQIQQUHEAMV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|