C13H19ClFN3O2 — CID 119501890
2-(3-fluorophenyl)-N-[2-[2-(methylamino)ethylamino]-2-oxoethyl]acetamide;hydrochloride (PubChem CID 119501890) has the molecular formula C13H19ClFN3O2 and a molecular weight of 303.76 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[2-[2-(methylamino)ethylamino]-2-oxoethyl]acetamide;hydrochloride.
| Compound Name | 2-(3-fluorophenyl)-N-[2-[2-(methylamino)ethylamino]-2-oxoethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119501890 |
| Molecular Formula | C13H19ClFN3O2 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[2-[2-(methylamino)ethylamino]-2-oxoethyl]acetamide;hydrochloride |
| SMILES | CNCCNC(=O)CNC(=O)Cc1cccc(F)c1.Cl |
| InChI | InChI=1S/C13H18FN3O2.ClH/c1-15-5-6-16-13(19)9-17-12(18)8-10-3-2-4-11(14)7-10;/h2-4,7,15H,5-6,8-9H2,1H3,(H,16,19)(H,17,18);1H |
| InChIKey | PQBJWODJNAPOLI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|