C11H16BrClN2O2 — CID 119502782
2-(3-bromophenoxy)-N-[2-(methylamino)ethyl]acetamide;hydrochloride (PubChem CID 119502782) has the molecular formula C11H16BrClN2O2 and a molecular weight of 323.62 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[2-(methylamino)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(3-bromophenoxy)-N-[2-(methylamino)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119502782 |
| Molecular Formula | C11H16BrClN2O2 |
| Molecular Weight | 323.62 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[2-(methylamino)ethyl]acetamide;hydrochloride |
| SMILES | CNCCNC(=O)COc1cccc(Br)c1.Cl |
| InChI | InChI=1S/C11H15BrN2O2.ClH/c1-13-5-6-14-11(15)8-16-10-4-2-3-9(12)7-10;/h2-4,7,13H,5-6,8H2,1H3,(H,14,15);1H |
| InChIKey | MMNVYLGFKOEVEG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|