C18H26N4O3 — CID 11950377
(E)-3-[2-(2,2-dimethylpropyl)-3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-6-yl]-N-hydroxyprop-2-enamide (PubChem CID 11950377) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (E)-3-[2-(2,2-dimethylpropyl)-3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-6-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-(2,2-dimethylpropyl)-3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-6-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 11950377 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (E)-3-[2-(2,2-dimethylpropyl)-3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-6-yl]-N-hydroxyprop-2-enamide |
| SMILES | COCCNc1c(CC(C)(C)C)nc2ccc(/C=C/C(=O)NO)cn12 |
| InChI | InChI=1S/C18H26N4O3/c1-18(2,3)11-14-17(19-9-10-25-4)22-12-13(5-7-15(22)20-14)6-8-16(23)21-24/h5-8,12,19,24H,9-11H2,1-4H3,(H,21,23)/b8-6+ |
| InChIKey | UGRWKQBWMIKPKM-SOFGYWHQSA-N |
| XLogP | 2.50 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|