C13H17ClN4O2 — CID 119504449
2-chloro-N-[2-(methylamino)ethyl]-5-(2-oxoimidazolidin-1-yl)benzamide (PubChem CID 119504449) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 2-chloro-N-[2-(methylamino)ethyl]-5-(2-oxoimidazolidin-1-yl)benzamide.
| Compound Name | 2-chloro-N-[2-(methylamino)ethyl]-5-(2-oxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 119504449 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-chloro-N-[2-(methylamino)ethyl]-5-(2-oxoimidazolidin-1-yl)benzamide |
| SMILES | CNCCNC(=O)c1cc(N2CCNC2=O)ccc1Cl |
| InChI | InChI=1S/C13H17ClN4O2/c1-15-4-5-16-12(19)10-8-9(2-3-11(10)14)18-7-6-17-13(18)20/h2-3,8,15H,4-7H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | YVHKQHRYLNUXGQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|