C15H25Cl2N5O — CID 119504676
N-[2-(ethylamino)ethyl]-6-methyl-1-propan-2-ylpyrazolo[3,4-b]pyridine-4-carboxamide;dihydrochloride (PubChem CID 119504676) has the molecular formula C15H25Cl2N5O and a molecular weight of 362.31 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-6-methyl-1-propan-2-ylpyrazolo[3,4-b]pyridine-4-carboxamide;dihydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-6-methyl-1-propan-2-ylpyrazolo[3,4-b]pyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119504676 |
| Molecular Formula | C15H25Cl2N5O |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-6-methyl-1-propan-2-ylpyrazolo[3,4-b]pyridine-4-carboxamide;dihydrochloride |
| SMILES | CCNCCNC(=O)c1cc(C)nc2c1cnn2C(C)C.Cl.Cl |
| InChI | InChI=1S/C15H23N5O.2ClH/c1-5-16-6-7-17-15(21)12-8-11(4)19-14-13(12)9-18-20(14)10(2)3;;/h8-10,16H,5-7H2,1-4H3,(H,17,21);2*1H |
| InChIKey | KOLYYIGUAJKWTK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|