C20H22ClN5O2 — CID 11950511
5-[2-amino-4-chloro-7-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-yn-1-ol (PubChem CID 11950511) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is 5-[2-amino-4-chloro-7-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-yn-1-ol.
| Compound Name | 5-[2-amino-4-chloro-7-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-yn-1-ol |
|---|---|
| PubChem CID | 11950511 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 5-[2-amino-4-chloro-7-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-yn-1-ol |
| SMILES | COc1c(C)cnc(Cn2cc(C#CCCCO)c3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C20H22ClN5O2/c1-12-9-23-15(13(2)17(12)28-3)11-26-10-14(7-5-4-6-8-27)16-18(21)24-20(22)25-19(16)26/h9-10,27H,4,6,8,11H2,1-3H3,(H2,22,24,25) |
| InChIKey | PZXQUSPCAXZHBY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|