C14H17BrN4O — CID 119505644
1-(3-bromophenyl)-N-[2-(ethylamino)ethyl]pyrazole-4-carboxamide (PubChem CID 119505644) has the molecular formula C14H17BrN4O and a molecular weight of 337.22 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[2-(ethylamino)ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-[2-(ethylamino)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119505644 |
| Molecular Formula | C14H17BrN4O |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-(3-bromophenyl)-N-[2-(ethylamino)ethyl]pyrazole-4-carboxamide |
| SMILES | CCNCCNC(=O)c1cnn(-c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C14H17BrN4O/c1-2-16-6-7-17-14(20)11-9-18-19(10-11)13-5-3-4-12(15)8-13/h3-5,8-10,16H,2,6-7H2,1H3,(H,17,20) |
| InChIKey | WKGRNDXIYNLUFX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|