C15H27Cl2N3O2 — CID 119506204
2-[2-(dimethylamino)ethoxy]-N-[2-(ethylamino)ethyl]benzamide;dihydrochloride (PubChem CID 119506204) has the molecular formula C15H27Cl2N3O2 and a molecular weight of 352.31 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]-N-[2-(ethylamino)ethyl]benzamide;dihydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethoxy]-N-[2-(ethylamino)ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119506204 |
| Molecular Formula | C15H27Cl2N3O2 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]-N-[2-(ethylamino)ethyl]benzamide;dihydrochloride |
| SMILES | CCNCCNC(=O)c1ccccc1OCCN(C)C.Cl.Cl |
| InChI | InChI=1S/C15H25N3O2.2ClH/c1-4-16-9-10-17-15(19)13-7-5-6-8-14(13)20-12-11-18(2)3;;/h5-8,16H,4,9-12H2,1-3H3,(H,17,19);2*1H |
| InChIKey | MTIAVVRABJGNIJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|