C18H21Cl2FN2O2 — CID 119506314
2-(2-chloro-4-fluorophenoxy)-N-[2-(ethylamino)ethyl]-2-phenylacetamide;hydrochloride (PubChem CID 119506314) has the molecular formula C18H21Cl2FN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-[2-(ethylamino)ethyl]-2-phenylacetamide;hydrochloride.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-[2-(ethylamino)ethyl]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119506314 |
| Molecular Formula | C18H21Cl2FN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-[2-(ethylamino)ethyl]-2-phenylacetamide;hydrochloride |
| SMILES | CCNCCNC(=O)C(Oc1ccc(F)cc1Cl)c1ccccc1.Cl |
| InChI | InChI=1S/C18H20ClFN2O2.ClH/c1-2-21-10-11-22-18(23)17(13-6-4-3-5-7-13)24-16-9-8-14(20)12-15(16)19;/h3-9,12,17,21H,2,10-11H2,1H3,(H,22,23);1H |
| InChIKey | TXCOPCBNVKMIQE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|