C32H34N6O4S — CID 11950689
2-[[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]carbamoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 11950689) has the molecular formula C32H34N6O4S and a molecular weight of 598.73 g/mol. Its IUPAC name is 2-[[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]carbamoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]carbamoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11950689 |
| Molecular Formula | C32H34N6O4S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 2-[[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]carbamoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)Nc1nc(N2CCN(C(=O)c3ccc(-c4ccccc4)cc3)CC2)c2cc(CC)sc2n1 |
| InChI | InChI=1S/C32H34N6O4S/c1-4-25-20-26-27(34-31(35-28(26)43-25)36-32(41)33-14-19-42-30(40)21(2)3)37-15-17-38(18-16-37)29(39)24-12-10-23(11-13-24)22-8-6-5-7-9-22/h5-13,20H,2,4,14-19H2,1,3H3,(H2,33,34,35,36,41) |
| InChIKey | YBKZCALSLUOTJT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|