C22H33N5O3S — CID 11950750
3-[[2-hexyl-7-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]-N-(2-methylsulfanylethyl)propanamide (PubChem CID 11950750) has the molecular formula C22H33N5O3S and a molecular weight of 447.61 g/mol. Its IUPAC name is 3-[[2-hexyl-7-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]-N-(2-methylsulfanylethyl)propanamide.
| Compound Name | 3-[[2-hexyl-7-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]-N-(2-methylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 11950750 |
| Molecular Formula | C22H33N5O3S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 3-[[2-hexyl-7-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]-N-(2-methylsulfanylethyl)propanamide |
| SMILES | CCCCCCc1nc2cc(/C=C/C(=O)NO)ccn2c1NCCC(=O)NCCSC |
| InChI | InChI=1S/C22H33N5O3S/c1-3-4-5-6-7-18-22(24-12-10-20(28)23-13-15-31-2)27-14-11-17(16-19(27)25-18)8-9-21(29)26-30/h8-9,11,14,16,24,30H,3-7,10,12-13,15H2,1-2H3,(H,23,28)(H,26,29)/b9-8+ |
| InChIKey | SARITOSNTXOTTR-CMDGGOBGSA-N |
| XLogP | 3.26 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|