C15H23ClN2O3S — CID 119507617
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N-[2-(ethylamino)ethyl]propanamide;hydrochloride (PubChem CID 119507617) has the molecular formula C15H23ClN2O3S and a molecular weight of 346.88 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N-[2-(ethylamino)ethyl]propanamide;hydrochloride.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N-[2-(ethylamino)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119507617 |
| Molecular Formula | C15H23ClN2O3S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N-[2-(ethylamino)ethyl]propanamide;hydrochloride |
| SMILES | CCNCCNC(=O)CCSc1ccc2c(c1)OCCO2.Cl |
| InChI | InChI=1S/C15H22N2O3S.ClH/c1-2-16-6-7-17-15(18)5-10-21-12-3-4-13-14(11-12)20-9-8-19-13;/h3-4,11,16H,2,5-10H2,1H3,(H,17,18);1H |
| InChIKey | DFKZACVGYYSVGU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|