C12H19ClN4O3 — CID 119507792
N-[2-(ethylamino)ethyl]-2-(2-nitroanilino)acetamide;hydrochloride (PubChem CID 119507792) has the molecular formula C12H19ClN4O3 and a molecular weight of 302.76 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-(2-nitroanilino)acetamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-(2-nitroanilino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119507792 |
| Molecular Formula | C12H19ClN4O3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-(2-nitroanilino)acetamide;hydrochloride |
| SMILES | CCNCCNC(=O)CNc1ccccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H18N4O3.ClH/c1-2-13-7-8-14-12(17)9-15-10-5-3-4-6-11(10)16(18)19;/h3-6,13,15H,2,7-9H2,1H3,(H,14,17);1H |
| InChIKey | XBQNDACSTTVSGX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|