C18H28ClN5OS — CID 119508053
1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119508053) has the molecular formula C18H28ClN5OS and a molecular weight of 397.98 g/mol. Its IUPAC name is 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119508053 |
| Molecular Formula | C18H28ClN5OS |
| Molecular Weight | 397.98 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)C1CCN(c2ncnc3sc(C)c(C)c23)CC1.Cl |
| InChI | InChI=1S/C18H27N5OS.ClH/c1-4-19-7-8-20-17(24)14-5-9-23(10-6-14)16-15-12(2)13(3)25-18(15)22-11-21-16;/h11,14,19H,4-10H2,1-3H3,(H,20,24);1H |
| InChIKey | HJNRWSTVQPNUSS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.98 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|