C15H20ClN3OS — CID 119508196
N-[2-(ethylamino)ethyl]-2-(2-methylphenyl)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119508196) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-(2-methylphenyl)-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-(2-methylphenyl)-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119508196 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-(2-methylphenyl)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1csc(-c2ccccc2C)n1.Cl |
| InChI | InChI=1S/C15H19N3OS.ClH/c1-3-16-8-9-17-14(19)13-10-20-15(18-13)12-7-5-4-6-11(12)2;/h4-7,10,16H,3,8-9H2,1-2H3,(H,17,19);1H |
| InChIKey | LFIAZGHMMAILHJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|