C9H14Cl2N2O2 — CID 119508521
5-chloro-N-[2-(ethylamino)ethyl]furan-2-carboxamide;hydrochloride (PubChem CID 119508521) has the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.13 g/mol. Its IUPAC name is 5-chloro-N-[2-(ethylamino)ethyl]furan-2-carboxamide;hydrochloride.
| Compound Name | 5-chloro-N-[2-(ethylamino)ethyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119508521 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 5-chloro-N-[2-(ethylamino)ethyl]furan-2-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccc(Cl)o1.Cl |
| InChI | InChI=1S/C9H13ClN2O2.ClH/c1-2-11-5-6-12-9(13)7-3-4-8(10)14-7;/h3-4,11H,2,5-6H2,1H3,(H,12,13);1H |
| InChIKey | CZNMXSQJWZTRMM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|