C17H29ClN2O2 — CID 119508717
N-[2-(ethylamino)ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)propanamide;hydrochloride (PubChem CID 119508717) has the molecular formula C17H29ClN2O2 and a molecular weight of 328.88 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)propanamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119508717 |
| Molecular Formula | C17H29ClN2O2 |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-(2-methyl-5-propan-2-ylphenoxy)propanamide;hydrochloride |
| SMILES | CCNCCNC(=O)C(C)Oc1cc(C(C)C)ccc1C.Cl |
| InChI | InChI=1S/C17H28N2O2.ClH/c1-6-18-9-10-19-17(20)14(5)21-16-11-15(12(2)3)8-7-13(16)4;/h7-8,11-12,14,18H,6,9-10H2,1-5H3,(H,19,20);1H |
| InChIKey | DFBDZUYEDKVXIU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|